dc.contributor.author | Καραγιώργου, Ουρανία | el |
dc.contributor.author | Παπαγιαννοπούλου, Διονυσία | el |
dc.contributor.author | Κυπριανίδου, Πατρίτσια | el |
dc.contributor.author | Πάτσης, Γεώργιος Π. | el |
dc.contributor.author | Παναγιωτοπούλου, Αγγελική | el |
dc.date.accessioned | 2015-06-07T21:00:18Z | |
dc.date.available | 2015-06-07T21:00:18Z | |
dc.date.issued | 2015-06-08 | |
dc.identifier.uri | http://hdl.handle.net/11400/15558 | |
dc.rights | Αναφορά Δημιουργού-Μη Εμπορική Χρήση-Όχι Παράγωγα Έργα 3.0 Ηνωμένες Πολιτείες | * |
dc.rights.uri | http://creativecommons.org/licenses/by-nc-nd/3.0/us/ | * |
dc.source | http://www.elsevier.com/ | en |
dc.subject | Carbonyls | |
dc.subject | Cysteine | |
dc.subject | Rhenium | |
dc.subject | Technetium-99m | |
dc.subject | καρβονύλια | |
dc.subject | κυστεΐνη | |
dc.subject | Ρήνειο | |
dc.title | Synthesis and structural characterization of novel neutral fac-M(CO)3(NSO) complexes (M = Re, 99mTc) with N-acetylcysteine derivatives as tridentate NSO ligands | en |
heal.type | journalArticle | |
heal.classification | Technology | |
heal.classification | Chemical technology | |
heal.classification | Τεχνολογία | |
heal.classification | Χημική τεχνολογία | |
heal.classificationURI | http://id.loc.gov/authorities/subjects/sh85133147 | |
heal.classificationURI | http://skos.um.es/unescothes/C00565 | |
heal.classificationURI | **N/A**-Τεχνολογία | |
heal.classificationURI | **N/A**-Χημική τεχνολογία | |
heal.contributorName | Τσουκαλάς, Χαράλαμπος | el |
heal.contributorName | Ραφτοπούλου, Αικατερίνη Π. | el |
heal.contributorName | Πελεκάνου, Μαρία | el |
heal.contributorName | Πιρμέττης, Ιωάννης Χ. | el |
heal.contributorName | Παπαδόπουλος, Μηνάς Σ. | el |
heal.identifier.secondary | DOI: 10.1016/j.poly.2009.05.010 | |
heal.language | en | |
heal.access | campus | |
heal.publicationDate | 2009-10-13 | |
heal.bibliographicCitation | KARAGIORGOU, O., PAPAGIANNOPOULOU, D., KYPRIANIDOU, P., PATSIS, G.P., PANAGIOTOPOULOU, A., et al. (2009). Synthesis and structural characterization of novel neutral fac-M(CO)3(NSO) complexes (M = Re, 99mTc) with N-acetylcysteine derivatives as tridentate NSO ligands. Polyhedron. [online] 28 (15). p. 3317-3321. Available from: http://www.elsevier.com/[Accessed 13/05/2009] | en |
heal.abstract | The reaction of [NEt4]2[Re(CO)3Br3] with equimolar amount of a tridentate NSO ligand in methanol leads to the formation of neutral tricarbonyl rhenium(I) complexes of the general formula Re(CO)3(NSO), where the NSO ligand is o-C5H4N-CH2CH2-S-CH2CH(NHCOCH3)COOH (L1H), complex 1 or o-C5H4N-CH2CH2-S-C(CH3)2CH(NHCOCH3)COOH (L2H), complex 2. Both complexes have been characterized by elemental analysis and spectroscopic methods, while complex 2 has also been characterized by X-rays analysis. At technetium-99m level, the corresponding fac-[99mTc(CO)3(NSO)] complexes 3 and 4, were obtained in high yield by reacting ligands L1H or L2H with the fac-[99mTc(CO)3(H2O)3]+ precursor in water. Their structure was established by chromatographic comparison to the prototype rhenium complex using high-performance liquid chromatographic techniques. | en |
heal.publisher | Elsevier | en |
heal.journalName | Polyhedron | en |
heal.journalType | peer-reviewed | |
heal.fullTextAvailability | true |
Οι παρακάτω άδειες σχετίζονται με αυτό το τεκμήριο: